C26H31N3OS — CID 4519202
1-[(4-tert-butylphenyl)methyl]-3-(2-methoxy-5-methylphenyl)-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 4519202) has the molecular formula C26H31N3OS and a molecular weight of 433.62 g/mol. Its IUPAC name is 1-[(4-tert-butylphenyl)methyl]-3-(2-methoxy-5-methylphenyl)-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-[(4-tert-butylphenyl)methyl]-3-(2-methoxy-5-methylphenyl)-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4519202 |
| Molecular Formula | C26H31N3OS |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 1-[(4-tert-butylphenyl)methyl]-3-(2-methoxy-5-methylphenyl)-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | COc1ccc(C)cc1NC(=S)N(Cc1ccc(C(C)(C)C)cc1)Cc1cccnc1 |
| InChI | InChI=1S/C26H31N3OS/c1-19-8-13-24(30-5)23(15-19)28-25(31)29(18-21-7-6-14-27-16-21)17-20-9-11-22(12-10-20)26(2,3)4/h6-16H,17-18H2,1-5H3,(H,28,31) |
| InChIKey | ICVQODCQWCKJTD-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|