C18H25N3OS — CID 17370487
1-(cyclohex-3-en-1-ylmethyl)-1-(oxolan-2-ylmethyl)-3-pyridin-3-ylthiourea (PubChem CID 17370487) has the molecular formula C18H25N3OS and a molecular weight of 331.48 g/mol. Its IUPAC name is 1-(cyclohex-3-en-1-ylmethyl)-1-(oxolan-2-ylmethyl)-3-pyridin-3-ylthiourea.
| Compound Name | 1-(cyclohex-3-en-1-ylmethyl)-1-(oxolan-2-ylmethyl)-3-pyridin-3-ylthiourea |
|---|---|
| PubChem CID | 17370487 |
| Molecular Formula | C18H25N3OS |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 1-(cyclohex-3-en-1-ylmethyl)-1-(oxolan-2-ylmethyl)-3-pyridin-3-ylthiourea |
| SMILES | S=C(Nc1cccnc1)N(CC1CC=CCC1)CC1CCCO1 |
| InChI | InChI=1S/C18H25N3OS/c23-18(20-16-8-4-10-19-12-16)21(14-17-9-5-11-22-17)13-15-6-2-1-3-7-15/h1-2,4,8,10,12,15,17H,3,5-7,9,11,13-14H2,(H,20,23) |
| InChIKey | MJEYLBZKJUXOIB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|