C20H28NO6P — CID 40561038
[3-[2-[[(1R)-cyclohex-3-en-1-yl]methyl-[[(2S)-oxolan-2-yl]methyl]amino]-2-oxoethoxy]phenyl]phosphonic acid (PubChem CID 40561038) has the molecular formula C20H28NO6P and a molecular weight of 409.42 g/mol. Its IUPAC name is [3-[2-[[(1R)-cyclohex-3-en-1-yl]methyl-[[(2S)-oxolan-2-yl]methyl]amino]-2-oxoethoxy]phenyl]phosphonic acid.
| Compound Name | [3-[2-[[(1R)-cyclohex-3-en-1-yl]methyl-[[(2S)-oxolan-2-yl]methyl]amino]-2-oxoethoxy]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 40561038 |
| Molecular Formula | C20H28NO6P |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | [3-[2-[[(1R)-cyclohex-3-en-1-yl]methyl-[[(2S)-oxolan-2-yl]methyl]amino]-2-oxoethoxy]phenyl]phosphonic acid |
| SMILES | O=C(COc1cccc(P(=O)(O)O)c1)N(C[C@H]1CC=CCC1)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C20H28NO6P/c22-20(15-27-17-8-4-10-19(12-17)28(23,24)25)21(14-18-9-5-11-26-18)13-16-6-2-1-3-7-16/h1-2,4,8,10,12,16,18H,3,5-7,9,11,13-15H2,(H2,23,24,25)/t16-,18-/m0/s1 |
| InChIKey | KOGGZYIDYWJHOD-WMZOPIPTSA-N |
| XLogP | 2.23 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|