C17H19ClFN3S — CID 17387781
1-[(2-chloro-6-fluorophenyl)methyl]-3-propyl-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 17387781) has the molecular formula C17H19ClFN3S and a molecular weight of 351.88 g/mol. Its IUPAC name is 1-[(2-chloro-6-fluorophenyl)methyl]-3-propyl-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-[(2-chloro-6-fluorophenyl)methyl]-3-propyl-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 17387781 |
| Molecular Formula | C17H19ClFN3S |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 1-[(2-chloro-6-fluorophenyl)methyl]-3-propyl-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | CCCNC(=S)N(Cc1cccnc1)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C17H19ClFN3S/c1-2-8-21-17(23)22(11-13-5-4-9-20-10-13)12-14-15(18)6-3-7-16(14)19/h3-7,9-10H,2,8,11-12H2,1H3,(H,21,23) |
| InChIKey | IVAYTXCODFFMGE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|