C14H13ClFN3O — CID 17393832
1-[(2-chloro-6-fluorophenyl)methyl]-1-methyl-3-pyridin-3-ylurea (PubChem CID 17393832) has the molecular formula C14H13ClFN3O and a molecular weight of 293.73 g/mol. Its IUPAC name is 1-[(2-chloro-6-fluorophenyl)methyl]-1-methyl-3-pyridin-3-ylurea.
| Compound Name | 1-[(2-chloro-6-fluorophenyl)methyl]-1-methyl-3-pyridin-3-ylurea |
|---|---|
| PubChem CID | 17393832 |
| Molecular Formula | C14H13ClFN3O |
| Molecular Weight | 293.73 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 1-[(2-chloro-6-fluorophenyl)methyl]-1-methyl-3-pyridin-3-ylurea |
| SMILES | CN(Cc1c(F)cccc1Cl)C(=O)Nc1cccnc1 |
| InChI | InChI=1S/C14H13ClFN3O/c1-19(9-11-12(15)5-2-6-13(11)16)14(20)18-10-4-3-7-17-8-10/h2-8H,9H2,1H3,(H,18,20) |
| InChIKey | MLUBFDJPOQQJOA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.73 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |