C16H17ClFN3O — CID 71969304
3-[2-(2-chloro-6-fluorophenyl)ethyl]-1-methyl-1-(pyridin-4-ylmethyl)urea (PubChem CID 71969304) has the molecular formula C16H17ClFN3O and a molecular weight of 321.78 g/mol. Its IUPAC name is 3-[2-(2-chloro-6-fluorophenyl)ethyl]-1-methyl-1-(pyridin-4-ylmethyl)urea.
| Compound Name | 3-[2-(2-chloro-6-fluorophenyl)ethyl]-1-methyl-1-(pyridin-4-ylmethyl)urea |
|---|---|
| PubChem CID | 71969304 |
| Molecular Formula | C16H17ClFN3O |
| Molecular Weight | 321.78 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 3-[2-(2-chloro-6-fluorophenyl)ethyl]-1-methyl-1-(pyridin-4-ylmethyl)urea |
| SMILES | CN(Cc1ccncc1)C(=O)NCCc1c(F)cccc1Cl |
| InChI | InChI=1S/C16H17ClFN3O/c1-21(11-12-5-8-19-9-6-12)16(22)20-10-7-13-14(17)3-2-4-15(13)18/h2-6,8-9H,7,10-11H2,1H3,(H,20,22) |
| InChIKey | ZSJZFSBNIVJQOY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.78 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |