C15H15ClFN3O2 — CID 51116678
1-[(2-chloro-6-fluorophenyl)methyl]-3-(2-methoxy-3-pyridinyl)-1-methylurea (PubChem CID 51116678) has the molecular formula C15H15ClFN3O2 and a molecular weight of 323.76 g/mol. Its IUPAC name is 1-[(2-chloro-6-fluorophenyl)methyl]-3-(2-methoxy-3-pyridinyl)-1-methylurea.
| Compound Name | 1-[(2-chloro-6-fluorophenyl)methyl]-3-(2-methoxy-3-pyridinyl)-1-methylurea |
|---|---|
| PubChem CID | 51116678 |
| Molecular Formula | C15H15ClFN3O2 |
| Molecular Weight | 323.76 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 1-[(2-chloro-6-fluorophenyl)methyl]-3-(2-methoxy-3-pyridinyl)-1-methylurea |
| SMILES | COc1ncccc1NC(=O)N(C)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C15H15ClFN3O2/c1-20(9-10-11(16)5-3-6-12(10)17)15(21)19-13-7-4-8-18-14(13)22-2/h3-8H,9H2,1-2H3,(H,19,21) |
| InChIKey | QTVWQNUAPYIQBZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.76 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |