C17H16ClFN2O2 — CID 134003236
N-[(2-chloro-6-fluorophenyl)methyl]-N-cyclopropyl-2-methoxypyridine-3-carboxamide (PubChem CID 134003236) has the molecular formula C17H16ClFN2O2 and a molecular weight of 334.78 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methyl]-N-cyclopropyl-2-methoxypyridine-3-carboxamide.
| Compound Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-cyclopropyl-2-methoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 134003236 |
| Molecular Formula | C17H16ClFN2O2 |
| Molecular Weight | 334.78 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-cyclopropyl-2-methoxypyridine-3-carboxamide |
| SMILES | COc1ncccc1C(=O)N(Cc1c(F)cccc1Cl)C1CC1 |
| InChI | InChI=1S/C17H16ClFN2O2/c1-23-16-12(4-3-9-20-16)17(22)21(11-7-8-11)10-13-14(18)5-2-6-15(13)19/h2-6,9,11H,7-8,10H2,1H3 |
| InChIKey | LXLBDUFHDLIAMP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.78 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |