C17H23ClFN3O2 — CID 122568629
4-[[(2-chloro-6-fluorophenyl)methyl-cyclopropylcarbamoyl]amino]-N,N-dimethylbutanamide (PubChem CID 122568629) has the molecular formula C17H23ClFN3O2 and a molecular weight of 355.84 g/mol. Its IUPAC name is 4-[[(2-chloro-6-fluorophenyl)methyl-cyclopropylcarbamoyl]amino]-N,N-dimethylbutanamide.
| Compound Name | 4-[[(2-chloro-6-fluorophenyl)methyl-cyclopropylcarbamoyl]amino]-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 122568629 |
| Molecular Formula | C17H23ClFN3O2 |
| Molecular Weight | 355.84 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 4-[[(2-chloro-6-fluorophenyl)methyl-cyclopropylcarbamoyl]amino]-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCCNC(=O)N(Cc1c(F)cccc1Cl)C1CC1 |
| InChI | InChI=1S/C17H23ClFN3O2/c1-21(2)16(23)7-4-10-20-17(24)22(12-8-9-12)11-13-14(18)5-3-6-15(13)19/h3,5-6,12H,4,7-11H2,1-2H3,(H,20,24) |
| InChIKey | JJYAKLNJYJQMAI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.84 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|