C17H21ClFN3O2 — CID 122570529
1-[(2-chloro-6-fluorophenyl)methyl]-1-cyclopropyl-3-(2-oxo-2-pyrrolidin-1-ylethyl)urea (PubChem CID 122570529) has the molecular formula C17H21ClFN3O2 and a molecular weight of 353.83 g/mol. Its IUPAC name is 1-[(2-chloro-6-fluorophenyl)methyl]-1-cyclopropyl-3-(2-oxo-2-pyrrolidin-1-ylethyl)urea.
| Compound Name | 1-[(2-chloro-6-fluorophenyl)methyl]-1-cyclopropyl-3-(2-oxo-2-pyrrolidin-1-ylethyl)urea |
|---|---|
| PubChem CID | 122570529 |
| Molecular Formula | C17H21ClFN3O2 |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 1-[(2-chloro-6-fluorophenyl)methyl]-1-cyclopropyl-3-(2-oxo-2-pyrrolidin-1-ylethyl)urea |
| SMILES | O=C(CNC(=O)N(Cc1c(F)cccc1Cl)C1CC1)N1CCCC1 |
| InChI | InChI=1S/C17H21ClFN3O2/c18-14-4-3-5-15(19)13(14)11-22(12-6-7-12)17(24)20-10-16(23)21-8-1-2-9-21/h3-5,12H,1-2,6-11H2,(H,20,24) |
| InChIKey | XBXSIMUYOSFMRX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |