C16H12Cl3FN2O — CID 46533927
3,6-dichloro-N-[(2-chloro-6-fluorophenyl)methyl]-N-cyclopropylpyridine-2-carboxamide (PubChem CID 46533927) has the molecular formula C16H12Cl3FN2O and a molecular weight of 373.64 g/mol. Its IUPAC name is 3,6-dichloro-N-[(2-chloro-6-fluorophenyl)methyl]-N-cyclopropylpyridine-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[(2-chloro-6-fluorophenyl)methyl]-N-cyclopropylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 46533927 |
| Molecular Formula | C16H12Cl3FN2O |
| Molecular Weight | 373.64 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | 3,6-dichloro-N-[(2-chloro-6-fluorophenyl)methyl]-N-cyclopropylpyridine-2-carboxamide |
| SMILES | O=C(c1nc(Cl)ccc1Cl)N(Cc1c(F)cccc1Cl)C1CC1 |
| InChI | InChI=1S/C16H12Cl3FN2O/c17-11-2-1-3-13(20)10(11)8-22(9-4-5-9)16(23)15-12(18)6-7-14(19)21-15/h1-3,6-7,9H,4-5,8H2 |
| InChIKey | BSQSXZYXRHDFKZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.64 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|