C15H18BrClFNO — CID 107909248
5-bromo-N-[(2-chloro-6-fluorophenyl)methyl]-N-cyclopropylpentanamide (PubChem CID 107909248) has the molecular formula C15H18BrClFNO and a molecular weight of 362.67 g/mol. Its IUPAC name is 5-bromo-N-[(2-chloro-6-fluorophenyl)methyl]-N-cyclopropylpentanamide.
| Compound Name | 5-bromo-N-[(2-chloro-6-fluorophenyl)methyl]-N-cyclopropylpentanamide |
|---|---|
| PubChem CID | 107909248 |
| Molecular Formula | C15H18BrClFNO |
| Molecular Weight | 362.67 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 5-bromo-N-[(2-chloro-6-fluorophenyl)methyl]-N-cyclopropylpentanamide |
| SMILES | O=C(CCCCBr)N(Cc1c(F)cccc1Cl)C1CC1 |
| InChI | InChI=1S/C15H18BrClFNO/c16-9-2-1-6-15(20)19(11-7-8-11)10-12-13(17)4-3-5-14(12)18/h3-5,11H,1-2,6-10H2 |
| InChIKey | VHSBUDCAHQFYGD-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.67 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|