C19H21ClFN3O2 — CID 121499125
1-[(2-chloro-6-fluorophenyl)methyl]-1-cyclopropyl-3-(2-pyridin-3-yloxypropyl)urea (PubChem CID 121499125) has the molecular formula C19H21ClFN3O2 and a molecular weight of 377.85 g/mol. Its IUPAC name is 1-[(2-chloro-6-fluorophenyl)methyl]-1-cyclopropyl-3-(2-pyridin-3-yloxypropyl)urea.
| Compound Name | 1-[(2-chloro-6-fluorophenyl)methyl]-1-cyclopropyl-3-(2-pyridin-3-yloxypropyl)urea |
|---|---|
| PubChem CID | 121499125 |
| Molecular Formula | C19H21ClFN3O2 |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 1-[(2-chloro-6-fluorophenyl)methyl]-1-cyclopropyl-3-(2-pyridin-3-yloxypropyl)urea |
| SMILES | CC(CNC(=O)N(Cc1c(F)cccc1Cl)C1CC1)Oc1cccnc1 |
| InChI | InChI=1S/C19H21ClFN3O2/c1-13(26-15-4-3-9-22-11-15)10-23-19(25)24(14-7-8-14)12-16-17(20)5-2-6-18(16)21/h2-6,9,11,13-14H,7-8,10,12H2,1H3,(H,23,25) |
| InChIKey | WJNIONVSNNUMIL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |