C20H17ClFN3O2 — CID 86769878
N'-[(2-chloro-6-fluorophenyl)methyl]-N'-methyl-N-(8-methylquinolin-5-yl)oxamide (PubChem CID 86769878) has the molecular formula C20H17ClFN3O2 and a molecular weight of 385.83 g/mol. Its IUPAC name is N'-[(2-chloro-6-fluorophenyl)methyl]-N'-methyl-N-(8-methylquinolin-5-yl)oxamide.
| Compound Name | N'-[(2-chloro-6-fluorophenyl)methyl]-N'-methyl-N-(8-methylquinolin-5-yl)oxamide |
|---|---|
| PubChem CID | 86769878 |
| Molecular Formula | C20H17ClFN3O2 |
| Molecular Weight | 385.83 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | N'-[(2-chloro-6-fluorophenyl)methyl]-N'-methyl-N-(8-methylquinolin-5-yl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)N(C)Cc2c(F)cccc2Cl)c2cccnc12 |
| InChI | InChI=1S/C20H17ClFN3O2/c1-12-8-9-17(13-5-4-10-23-18(12)13)24-19(26)20(27)25(2)11-14-15(21)6-3-7-16(14)22/h3-10H,11H2,1-2H3,(H,24,26) |
| InChIKey | PMJZRKGAMOJCFY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.83 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|