C20H17ClFN3S — CID 4160320
3-(4-chlorophenyl)-1-[(3-fluorophenyl)methyl]-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 4160320) has the molecular formula C20H17ClFN3S and a molecular weight of 385.90 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-[(3-fluorophenyl)methyl]-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 3-(4-chlorophenyl)-1-[(3-fluorophenyl)methyl]-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4160320 |
| Molecular Formula | C20H17ClFN3S |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 3-(4-chlorophenyl)-1-[(3-fluorophenyl)methyl]-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | Fc1cccc(CN(Cc2cccnc2)C(=S)Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C20H17ClFN3S/c21-17-6-8-19(9-7-17)24-20(26)25(14-16-4-2-10-23-12-16)13-15-3-1-5-18(22)11-15/h1-12H,13-14H2,(H,24,26) |
| InChIKey | UVHCYEMCGLCXRS-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|