C24H27N3O4S — CID 4250092
3-(2,4-dimethoxyphenyl)-1-[(2,3-dimethoxyphenyl)methyl]-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 4250092) has the molecular formula C24H27N3O4S and a molecular weight of 453.56 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-1-[(2,3-dimethoxyphenyl)methyl]-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 3-(2,4-dimethoxyphenyl)-1-[(2,3-dimethoxyphenyl)methyl]-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4250092 |
| Molecular Formula | C24H27N3O4S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-1-[(2,3-dimethoxyphenyl)methyl]-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | COc1ccc(NC(=S)N(Cc2cccnc2)Cc2cccc(OC)c2OC)c(OC)c1 |
| InChI | InChI=1S/C24H27N3O4S/c1-28-19-10-11-20(22(13-19)30-3)26-24(32)27(15-17-7-6-12-25-14-17)16-18-8-5-9-21(29-2)23(18)31-4/h5-14H,15-16H2,1-4H3,(H,26,32) |
| InChIKey | FBDZDTXNMONKAG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 65.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|