C28H27F3N6O5 — CID 129237006
N-(2,6-dioxopiperidin-3-yl)-2-formyl-N-methyl-3-[[4-[[2-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]methyl]phenyl]methoxy]benzamide (PubChem CID 129237006) has the molecular formula C28H27F3N6O5 and a molecular weight of 584.56 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-2-formyl-N-methyl-3-[[4-[[2-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]methyl]phenyl]methoxy]benzamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-2-formyl-N-methyl-3-[[4-[[2-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]methyl]phenyl]methoxy]benzamide |
|---|---|
| PubChem CID | 129237006 |
| Molecular Formula | C28H27F3N6O5 |
| Molecular Weight | 584.56 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-2-formyl-N-methyl-3-[[4-[[2-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-7-yl]methyl]phenyl]methoxy]benzamide |
| SMILES | CN(C(=O)c1cccc(OCc2ccc(CN3CCn4nc(C(F)(F)F)nc4C3)cc2)c1C=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C28H27F3N6O5/c1-35(21-9-10-24(39)33-25(21)40)26(41)19-3-2-4-22(20(19)15-38)42-16-18-7-5-17(6-8-18)13-36-11-12-37-23(14-36)32-27(34-37)28(29,30)31/h2-8,15,21H,9-14,16H2,1H3,(H,33,39,40) |
| InChIKey | WADQSNQPFUFHDY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 126.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.56 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|