C20H12F3N — CID 24799493
2,2-bis(3-fluorophenyl)-2-(4-fluorophenyl)acetonitrile (PubChem CID 24799493) has the molecular formula C20H12F3N and a molecular weight of 323.32 g/mol. Its IUPAC name is 2,2-bis(3-fluorophenyl)-2-(4-fluorophenyl)acetonitrile.
| Compound Name | 2,2-bis(3-fluorophenyl)-2-(4-fluorophenyl)acetonitrile |
|---|---|
| PubChem CID | 24799493 |
| Molecular Formula | C20H12F3N |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 2,2-bis(3-fluorophenyl)-2-(4-fluorophenyl)acetonitrile |
| SMILES | N#CC(c1ccc(F)cc1)(c1cccc(F)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C20H12F3N/c21-17-9-7-14(8-10-17)20(13-24,15-3-1-5-18(22)11-15)16-4-2-6-19(23)12-16/h1-12H |
| InChIKey | XVRLDUCPWNZZNW-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|