C15H17Br2NOTe — CID 23265035
4-[dibromo-(4-methoxyphenyl)-λ4-tellanyl]-N,N-dimethylaniline (PubChem CID 23265035) has the molecular formula C15H17Br2NOTe and a molecular weight of 514.72 g/mol. Its IUPAC name is 4-[dibromo-(4-methoxyphenyl)-λ4-tellanyl]-N,N-dimethylaniline.
| Compound Name | 4-[dibromo-(4-methoxyphenyl)-λ4-tellanyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 23265035 |
| Molecular Formula | C15H17Br2NOTe |
| Molecular Weight | 514.72 g/mol |
| Exact Mass | 514.87 |
| IUPAC Name | 4-[dibromo-(4-methoxyphenyl)-λ4-tellanyl]-N,N-dimethylaniline |
| SMILES | COc1ccc([Te](Br)(Br)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C15H17Br2NOTe/c1-18(2)12-4-8-14(9-5-12)20(16,17)15-10-6-13(19-3)7-11-15/h4-11H,1-3H3 |
| InChIKey | DXVKTSBQKUPZNR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.72 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|