C31H28IN3O2 — CID 176897042
N,N-bis(4-methoxyphenyl)-2-[2-(1-methylpyridin-1-ium-4-yl)ethenyl]quinolin-6-amine iodide (PubChem CID 176897042) has the molecular formula C31H28IN3O2 and a molecular weight of 601.49 g/mol. Its IUPAC name is N,N-bis(4-methoxyphenyl)-2-[2-(1-methylpyridin-1-ium-4-yl)ethenyl]quinolin-6-amine iodide.
| Compound Name | N,N-bis(4-methoxyphenyl)-2-[2-(1-methylpyridin-1-ium-4-yl)ethenyl]quinolin-6-amine iodide |
|---|---|
| PubChem CID | 176897042 |
| Molecular Formula | C31H28IN3O2 |
| Molecular Weight | 601.49 g/mol |
| Exact Mass | 601.12 |
| IUPAC Name | N,N-bis(4-methoxyphenyl)-2-[2-(1-methylpyridin-1-ium-4-yl)ethenyl]quinolin-6-amine iodide |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccc3nc(C=Cc4cc[n+](C)cc4)ccc3c2)cc1.[I-] |
| InChI | InChI=1S/C31H28N3O2.HI/c1-33-20-18-23(19-21-33)4-6-25-7-5-24-22-28(12-17-31(24)32-25)34(26-8-13-29(35-2)14-9-26)27-10-15-30(36-3)16-11-27;/h4-22H,1-3H3;1H/q+1;/p-1 |
| InChIKey | ZDMBINQYUOFUFU-UHFFFAOYSA-M |
| XLogP | 3.72 |
| TPSA | 38.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|