C22H25IN2O5S — CID 144970931
tert-butyl N-[4-[5-(3-iodosulfanyloxypropoxy)-1,3-benzoxazol-2-yl]phenyl]-N-methylcarbamate (PubChem CID 144970931) has the molecular formula C22H25IN2O5S and a molecular weight of 556.42 g/mol. Its IUPAC name is tert-butyl N-[4-[5-(3-iodosulfanyloxypropoxy)-1,3-benzoxazol-2-yl]phenyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[4-[5-(3-iodosulfanyloxypropoxy)-1,3-benzoxazol-2-yl]phenyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 144970931 |
| Molecular Formula | C22H25IN2O5S |
| Molecular Weight | 556.42 g/mol |
| Exact Mass | 556.05 |
| IUPAC Name | tert-butyl N-[4-[5-(3-iodosulfanyloxypropoxy)-1,3-benzoxazol-2-yl]phenyl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)c1ccc(-c2nc3cc(OCCCOSI)ccc3o2)cc1 |
| InChI | InChI=1S/C22H25IN2O5S/c1-22(2,3)30-21(26)25(4)16-8-6-15(7-9-16)20-24-18-14-17(10-11-19(18)29-20)27-12-5-13-28-31-23/h6-11,14H,5,12-13H2,1-4H3 |
| InChIKey | YCJGVWFTTOLMCS-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 74.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.42 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|