About tert-butyl carbamate;2-(2-methylpropoxy)propyl propanoate;toluene
tert-butyl carbamate;2-(2-methylpropoxy)propyl propanoate;toluene (PubChem CID 145115480) has the molecular formula C22H39NO5
and a molecular weight of 397.56 g/mol. Its IUPAC name is tert-butyl carbamate;2-(2-methylpropoxy)propyl propanoate;toluene.
Molecular Properties
| Compound Name | tert-butyl carbamate;2-(2-methylpropoxy)propyl propanoate;toluene |
| PubChem CID | 145115480 |
| Molecular Formula | C22H39NO5 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.28 |
| IUPAC Name | tert-butyl carbamate;2-(2-methylpropoxy)propyl propanoate;toluene |
| SMILES | CC(C)(C)OC(N)=O.CCC(=O)OCC(C)OCC(C)C.Cc1ccccc1 |
| InChI | InChI=1S/C10H20O3.C7H8.C5H11NO2/c1-5-10(11)13-7-9(4)12-6-8(2)3;1-7-5-3-2-4-6-7;1-5(2,3)8-4(6)7/h8-9H,5-7H2,1-4H3;2-6H,1H3;1-3H3,(H2,6,7) |
| InChIKey | YAFFJFRVMRHJHK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl carbamate;2-(2-methylpropoxy)propyl propanoate;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl carbamate;2-(2-methylpropoxy)propyl propanoate;toluene?
The IUPAC name of tert-butyl carbamate;2-(2-methylpropoxy)propyl propanoate;toluene (CID 145115480) is tert-butyl carbamate;2-(2-methylpropoxy)propyl propanoate;toluene.
What is the SMILES notation for tert-butyl carbamate;2-(2-methylpropoxy)propyl propanoate;toluene?
The canonical SMILES for tert-butyl carbamate;2-(2-methylpropoxy)propyl propanoate;toluene is CC(C)(C)OC(N)=O.CCC(=O)OCC(C)OCC(C)C.Cc1ccccc1.
What is the InChIKey of tert-butyl carbamate;2-(2-methylpropoxy)propyl propanoate;toluene?
The InChIKey is YAFFJFRVMRHJHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O3.C7H8.C5H11NO2/c1-5-10(11)13-7-9(4)12-6-8(2)3;1-7-5-3-2-4-6-7;1-5(2,3)8-4(6)7/h8-9H,5-7H2,1-4H3;2-6H,1H3;1-3H3,(H2,6,7).
What are the key properties of tert-butyl carbamate;2-(2-methylpropoxy)propyl propanoate;toluene?
tert-butyl carbamate;2-(2-methylpropoxy)propyl propanoate;toluene has a molecular weight of 397.56 g/mol, XLogP of 4.88, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl carbamate;2-(2-methylpropoxy)propyl propanoate;toluene is sourced from PubChem (CID 145115480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).