C9H2ClF6N3OS — CID 141497315
3-(trifluoromethyl)-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]pyrazole-5-carbonyl chloride (PubChem CID 141497315) has the molecular formula C9H2ClF6N3OS and a molecular weight of 349.64 g/mol. Its IUPAC name is 3-(trifluoromethyl)-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]pyrazole-5-carbonyl chloride.
| Compound Name | 3-(trifluoromethyl)-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]pyrazole-5-carbonyl chloride |
|---|---|
| PubChem CID | 141497315 |
| Molecular Formula | C9H2ClF6N3OS |
| Molecular Weight | 349.64 g/mol |
| Exact Mass | 348.95 |
| IUPAC Name | 3-(trifluoromethyl)-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]pyrazole-5-carbonyl chloride |
| SMILES | O=C(Cl)c1cc(C(F)(F)F)nn1-c1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C9H2ClF6N3OS/c10-6(20)3-1-4(8(11,12)13)18-19(3)7-17-5(2-21-7)9(14,15)16/h1-2H |
| InChIKey | OEMJEVVBKVWFLI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.64 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|