C8H7N2O2S- — CID 91884818
3-ethylimidazo[2,1-b][1,3]thiazole-6-carboxylate (PubChem CID 91884818) has the molecular formula C8H7N2O2S- and a molecular weight of 195.22 g/mol. Its IUPAC name is 3-ethylimidazo[2,1-b][1,3]thiazole-6-carboxylate.
| Compound Name | 3-ethylimidazo[2,1-b][1,3]thiazole-6-carboxylate |
|---|---|
| PubChem CID | 91884818 |
| Molecular Formula | C8H7N2O2S- |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.02 |
| IUPAC Name | 3-ethylimidazo[2,1-b][1,3]thiazole-6-carboxylate |
| SMILES | CCc1csc2nc(C(=O)[O-])cn12 |
| InChI | InChI=1S/C8H8N2O2S/c1-2-5-4-13-8-9-6(7(11)12)3-10(5)8/h3-4H,2H2,1H3,(H,11,12)/p-1 |
| InChIKey | CTFKAWCRHKRICT-UHFFFAOYSA-M |
| XLogP | 0.32 |
| TPSA | 57.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |