C15H22N2O2S — CID 67639380
heptan-2-yl 3-ethylimidazo[2,1-b][1,3]thiazole-6-carboxylate (PubChem CID 67639380) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is heptan-2-yl 3-ethylimidazo[2,1-b][1,3]thiazole-6-carboxylate.
| Compound Name | heptan-2-yl 3-ethylimidazo[2,1-b][1,3]thiazole-6-carboxylate |
|---|---|
| PubChem CID | 67639380 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | heptan-2-yl 3-ethylimidazo[2,1-b][1,3]thiazole-6-carboxylate |
| SMILES | CCCCCC(C)OC(=O)c1cn2c(CC)csc2n1 |
| InChI | InChI=1S/C15H22N2O2S/c1-4-6-7-8-11(3)19-14(18)13-9-17-12(5-2)10-20-15(17)16-13/h9-11H,4-8H2,1-3H3 |
| InChIKey | JRKUTIIOBUXGAP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|