C29H40N2O4S — CID 139762319
[(2S)-octan-2-yl] 2-[4-[(2S)-octan-2-yl]oxycarbonylphenyl]imidazo[2,1-b][1,3]thiazole-6-carboxylate (PubChem CID 139762319) has the molecular formula C29H40N2O4S and a molecular weight of 512.72 g/mol. Its IUPAC name is [(2S)-octan-2-yl] 2-[4-[(2S)-octan-2-yl]oxycarbonylphenyl]imidazo[2,1-b][1,3]thiazole-6-carboxylate.
| Compound Name | [(2S)-octan-2-yl] 2-[4-[(2S)-octan-2-yl]oxycarbonylphenyl]imidazo[2,1-b][1,3]thiazole-6-carboxylate |
|---|---|
| PubChem CID | 139762319 |
| Molecular Formula | C29H40N2O4S |
| Molecular Weight | 512.72 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | [(2S)-octan-2-yl] 2-[4-[(2S)-octan-2-yl]oxycarbonylphenyl]imidazo[2,1-b][1,3]thiazole-6-carboxylate |
| SMILES | CCCCCC[C@H](C)OC(=O)c1ccc(-c2cn3cc(C(=O)O[C@@H](C)CCCCCC)nc3s2)cc1 |
| InChI | InChI=1S/C29H40N2O4S/c1-5-7-9-11-13-21(3)34-27(32)24-17-15-23(16-18-24)26-20-31-19-25(30-29(31)36-26)28(33)35-22(4)14-12-10-8-6-2/h15-22H,5-14H2,1-4H3/t21-,22-/m0/s1 |
| InChIKey | TUPZKGMPJUPONI-VXKWHMMOSA-N |
| XLogP | 8.09 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.72 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|