C27H38N2O2S — CID 139762322
[(2R)-octan-2-yl] 4-(6-heptylimidazo[2,1-b][1,3]thiazol-2-yl)benzoate (PubChem CID 139762322) has the molecular formula C27H38N2O2S and a molecular weight of 454.68 g/mol. Its IUPAC name is [(2R)-octan-2-yl] 4-(6-heptylimidazo[2,1-b][1,3]thiazol-2-yl)benzoate.
| Compound Name | [(2R)-octan-2-yl] 4-(6-heptylimidazo[2,1-b][1,3]thiazol-2-yl)benzoate |
|---|---|
| PubChem CID | 139762322 |
| Molecular Formula | C27H38N2O2S |
| Molecular Weight | 454.68 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | [(2R)-octan-2-yl] 4-(6-heptylimidazo[2,1-b][1,3]thiazol-2-yl)benzoate |
| SMILES | CCCCCCCc1cn2cc(-c3ccc(C(=O)O[C@H](C)CCCCCC)cc3)sc2n1 |
| InChI | InChI=1S/C27H38N2O2S/c1-4-6-8-10-12-14-24-19-29-20-25(32-27(29)28-24)22-15-17-23(18-16-22)26(30)31-21(3)13-11-9-7-5-2/h15-21H,4-14H2,1-3H3/t21-/m1/s1 |
| InChIKey | QEBVLKNJCXNYRR-OAQYLSRUSA-N |
| XLogP | 8.09 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.68 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|