C10H10F3NOS — CID 89205407
2-phenyl-N-(2,2,2-trifluoroethylsulfanyl)acetamide (PubChem CID 89205407) has the molecular formula C10H10F3NOS and a molecular weight of 249.26 g/mol. Its IUPAC name is 2-phenyl-N-(2,2,2-trifluoroethylsulfanyl)acetamide.
| Compound Name | 2-phenyl-N-(2,2,2-trifluoroethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 89205407 |
| Molecular Formula | C10H10F3NOS |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 2-phenyl-N-(2,2,2-trifluoroethylsulfanyl)acetamide |
| SMILES | O=C(Cc1ccccc1)NSCC(F)(F)F |
| InChI | InChI=1S/C10H10F3NOS/c11-10(12,13)7-16-14-9(15)6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,14,15) |
| InChIKey | AEFBLKBUZSXBTI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|