C17H12F7NOS — CID 2217988
N-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)phenyl]-2-phenylacetamide (PubChem CID 2217988) has the molecular formula C17H12F7NOS and a molecular weight of 411.34 g/mol. Its IUPAC name is N-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)phenyl]-2-phenylacetamide.
| Compound Name | N-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 2217988 |
| Molecular Formula | C17H12F7NOS |
| Molecular Weight | 411.34 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | N-[4-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)phenyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)Nc1ccc(SC(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H12F7NOS/c18-15(19,16(20,21)22)17(23,24)27-13-8-6-12(7-9-13)25-14(26)10-11-4-2-1-3-5-11/h1-9H,10H2,(H,25,26) |
| InChIKey | LDBAZQLNJBSMLP-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.34 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|