C23H24N2OS — CID 174417066
(2-benzyl-1,3-diphenylpropan-2-yl)sulfanylurea (PubChem CID 174417066) has the molecular formula C23H24N2OS and a molecular weight of 376.53 g/mol. Its IUPAC name is (2-benzyl-1,3-diphenylpropan-2-yl)sulfanylurea.
| Compound Name | (2-benzyl-1,3-diphenylpropan-2-yl)sulfanylurea |
|---|---|
| PubChem CID | 174417066 |
| Molecular Formula | C23H24N2OS |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | (2-benzyl-1,3-diphenylpropan-2-yl)sulfanylurea |
| SMILES | NC(=O)NSC(Cc1ccccc1)(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H24N2OS/c24-22(26)25-27-23(16-19-10-4-1-5-11-19,17-20-12-6-2-7-13-20)18-21-14-8-3-9-15-21/h1-15H,16-18H2,(H3,24,25,26) |
| InChIKey | CMURDGQWKIJFOP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|