C11H14N2O2 — CID 149178833
(2R)-2-formamido-2-methyl-3-phenylpropanamide (PubChem CID 149178833) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is (2R)-2-formamido-2-methyl-3-phenylpropanamide.
| Compound Name | (2R)-2-formamido-2-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 149178833 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | (2R)-2-formamido-2-methyl-3-phenylpropanamide |
| SMILES | C[C@](Cc1ccccc1)(NC=O)C(N)=O |
| InChI | InChI=1S/C11H14N2O2/c1-11(10(12)15,13-8-14)7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H2,12,15)(H,13,14)/t11-/m1/s1 |
| InChIKey | XANUIPNOHLQBBZ-LLVKDONJSA-N |
| XLogP | 0.22 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|