C18H22N4O2 — CID 123330298
2-[(4-aminophenyl)methylcarbamoylamino]-2-methyl-3-phenylpropanamide (PubChem CID 123330298) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-[(4-aminophenyl)methylcarbamoylamino]-2-methyl-3-phenylpropanamide.
| Compound Name | 2-[(4-aminophenyl)methylcarbamoylamino]-2-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 123330298 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 2-[(4-aminophenyl)methylcarbamoylamino]-2-methyl-3-phenylpropanamide |
| SMILES | CC(Cc1ccccc1)(NC(=O)NCc1ccc(N)cc1)C(N)=O |
| InChI | InChI=1S/C18H22N4O2/c1-18(16(20)23,11-13-5-3-2-4-6-13)22-17(24)21-12-14-7-9-15(19)10-8-14/h2-10H,11-12,19H2,1H3,(H2,20,23)(H2,21,22,24) |
| InChIKey | BCHFMKTZRTYEIU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|