C16H17NO — CID 10490565
N-[2-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-1-phenylpropan-2-yl]formamide (PubChem CID 10490565) has the molecular formula C16H17NO and a molecular weight of 245.27 g/mol. Its IUPAC name is N-[2-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-1-phenylpropan-2-yl]formamide.
| Compound Name | N-[2-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-1-phenylpropan-2-yl]formamide |
|---|---|
| PubChem CID | 10490565 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | N-[2-((1,2,3,4,5,6-13C6)cyclohexatrienyl)-1-phenylpropan-2-yl]formamide |
| SMILES | CC(Cc1ccccc1)(NC=O)[13c]1[13cH][13cH][13cH][13cH][13cH]1 |
| InChI | InChI=1S/C16H17NO/c1-16(17-13-18,15-10-6-3-7-11-15)12-14-8-4-2-5-9-14/h2-11,13H,12H2,1H3,(H,17,18)/i3+1,6+1,7+1,10+1,11+1,15+1 |
| InChIKey | YBDZAUILXDHUHI-MGHJGXGKSA-N |
| XLogP | 2.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|