C13H10N2O2 — CID 145445802
methyl pyrazino[1,2-a]indole-3-carboxylate (PubChem CID 145445802) has the molecular formula C13H10N2O2 and a molecular weight of 226.23 g/mol. Its IUPAC name is methyl pyrazino[1,2-a]indole-3-carboxylate.
| Compound Name | methyl pyrazino[1,2-a]indole-3-carboxylate |
|---|---|
| PubChem CID | 145445802 |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | methyl pyrazino[1,2-a]indole-3-carboxylate |
| SMILES | COC(=O)c1cn2c(cn1)cc1ccccc12 |
| InChI | InChI=1S/C13H10N2O2/c1-17-13(16)11-8-15-10(7-14-11)6-9-4-2-3-5-12(9)15/h2-8H,1H3 |
| InChIKey | IHNRSYZWURZDPR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |