methyl pyrrolo[1,2-a]quinoline-2-carboxylate

C14H11NO2 — CID 122223914

IUPACmethyl pyrrolo[1,2-a]quinoline-2-carboxylate
SMILESCOC(=O)c1cc2ccc3ccccc3n2c1
InChIInChI=1S/C14H11NO2/c1-17-14(16)11-8-12-7-6-10-4-2-3-5-13(10)15(12)9-11/h2-9H,1H3
InChIKeyDPCGJSWTQDCFKJ-UHFFFAOYSA-N
MW225.25 g/mol
LogP2.88
Rot. Bonds1

About methyl pyrrolo[1,2-a]quinoline-2-carboxylate

methyl pyrrolo[1,2-a]quinoline-2-carboxylate (PubChem CID 122223914) has the molecular formula C14H11NO2 and a molecular weight of 225.25 g/mol. Its IUPAC name is methyl pyrrolo[1,2-a]quinoline-2-carboxylate.

Molecular Properties

Compound Namemethyl pyrrolo[1,2-a]quinoline-2-carboxylate
PubChem CID122223914
Molecular FormulaC14H11NO2
Molecular Weight225.25 g/mol
Exact Mass225.08
IUPAC Namemethyl pyrrolo[1,2-a]quinoline-2-carboxylate
SMILESCOC(=O)c1cc2ccc3ccccc3n2c1
InChIInChI=1S/C14H11NO2/c1-17-14(16)11-8-12-7-6-10-4-2-3-5-13(10)15(12)9-11/h2-9H,1H3
InChIKeyDPCGJSWTQDCFKJ-UHFFFAOYSA-N
XLogP2.88
TPSA30.71 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.25
LogP ≤ 52.88
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl pyrrolo[1,2-a]quinoline-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl pyrrolo[1,2-a]quinoline-2-carboxylate?
The IUPAC name of methyl pyrrolo[1,2-a]quinoline-2-carboxylate (CID 122223914) is methyl pyrrolo[1,2-a]quinoline-2-carboxylate.
What is the SMILES notation for methyl pyrrolo[1,2-a]quinoline-2-carboxylate?
The canonical SMILES for methyl pyrrolo[1,2-a]quinoline-2-carboxylate is COC(=O)c1cc2ccc3ccccc3n2c1.
What is the InChIKey of methyl pyrrolo[1,2-a]quinoline-2-carboxylate?
The InChIKey is DPCGJSWTQDCFKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO2/c1-17-14(16)11-8-12-7-6-10-4-2-3-5-13(10)15(12)9-11/h2-9H,1H3.
What are the key properties of methyl pyrrolo[1,2-a]quinoline-2-carboxylate?
methyl pyrrolo[1,2-a]quinoline-2-carboxylate has a molecular weight of 225.25 g/mol, XLogP of 2.88, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl pyrrolo[1,2-a]quinoline-2-carboxylate is sourced from PubChem (CID 122223914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).