C22H18N4O3S — CID 155519442
1-(4-benzoylpiperazin-1-yl)-2-imidazo[2,1-b][1,3]benzothiazol-2-ylethane-1,2-dione (PubChem CID 155519442) has the molecular formula C22H18N4O3S and a molecular weight of 418.48 g/mol. Its IUPAC name is 1-(4-benzoylpiperazin-1-yl)-2-imidazo[2,1-b][1,3]benzothiazol-2-ylethane-1,2-dione.
| Compound Name | 1-(4-benzoylpiperazin-1-yl)-2-imidazo[2,1-b][1,3]benzothiazol-2-ylethane-1,2-dione |
|---|---|
| PubChem CID | 155519442 |
| Molecular Formula | C22H18N4O3S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 1-(4-benzoylpiperazin-1-yl)-2-imidazo[2,1-b][1,3]benzothiazol-2-ylethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCN(C(=O)c2ccccc2)CC1)c1cn2c(n1)sc1ccccc12 |
| InChI | InChI=1S/C22H18N4O3S/c27-19(16-14-26-17-8-4-5-9-18(17)30-22(26)23-16)21(29)25-12-10-24(11-13-25)20(28)15-6-2-1-3-7-15/h1-9,14H,10-13H2 |
| InChIKey | JMCOCRWFKWFOKS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 74.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|