C30H30N2O2 — CID 46090574
N-[3-[6-(4-methoxyphenyl)-2-pyridinyl]phenyl]-4-pentylbenzamide (PubChem CID 46090574) has the molecular formula C30H30N2O2 and a molecular weight of 450.58 g/mol. Its IUPAC name is N-[3-[6-(4-methoxyphenyl)-2-pyridinyl]phenyl]-4-pentylbenzamide.
| Compound Name | N-[3-[6-(4-methoxyphenyl)-2-pyridinyl]phenyl]-4-pentylbenzamide |
|---|---|
| PubChem CID | 46090574 |
| Molecular Formula | C30H30N2O2 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | N-[3-[6-(4-methoxyphenyl)-2-pyridinyl]phenyl]-4-pentylbenzamide |
| SMILES | CCCCCc1ccc(C(=O)Nc2cccc(-c3cccc(-c4ccc(OC)cc4)n3)c2)cc1 |
| InChI | InChI=1S/C30H30N2O2/c1-3-4-5-8-22-13-15-24(16-14-22)30(33)31-26-10-6-9-25(21-26)29-12-7-11-28(32-29)23-17-19-27(34-2)20-18-23/h6-7,9-21H,3-5,8H2,1-2H3,(H,31,33) |
| InChIKey | LJGSWMLCWQSMCQ-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|