C17H10FN5O2S — CID 108775964
6-fluoro-N-[6-(3-nitrophenyl)pyridazin-3-yl]-1,3-benzothiazol-2-amine (PubChem CID 108775964) has the molecular formula C17H10FN5O2S and a molecular weight of 367.37 g/mol. Its IUPAC name is 6-fluoro-N-[6-(3-nitrophenyl)pyridazin-3-yl]-1,3-benzothiazol-2-amine.
| Compound Name | 6-fluoro-N-[6-(3-nitrophenyl)pyridazin-3-yl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 108775964 |
| Molecular Formula | C17H10FN5O2S |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | 6-fluoro-N-[6-(3-nitrophenyl)pyridazin-3-yl]-1,3-benzothiazol-2-amine |
| SMILES | O=[N+]([O-])c1cccc(-c2ccc(Nc3nc4ccc(F)cc4s3)nn2)c1 |
| InChI | InChI=1S/C17H10FN5O2S/c18-11-4-5-14-15(9-11)26-17(19-14)20-16-7-6-13(21-22-16)10-2-1-3-12(8-10)23(24)25/h1-9H,(H,19,20,22) |
| InChIKey | QESKHZXZEUVDHE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|