C24H14FN3O5S — CID 123890534
[1-(6-fluoro-1,3-benzothiazol-2-yl)-4,5-dihydroxy-2-(3-nitrophenyl)pyrrol-3-yl]-phenylmethanone (PubChem CID 123890534) has the molecular formula C24H14FN3O5S and a molecular weight of 475.46 g/mol. Its IUPAC name is [1-(6-fluoro-1,3-benzothiazol-2-yl)-4,5-dihydroxy-2-(3-nitrophenyl)pyrrol-3-yl]-phenylmethanone.
| Compound Name | [1-(6-fluoro-1,3-benzothiazol-2-yl)-4,5-dihydroxy-2-(3-nitrophenyl)pyrrol-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 123890534 |
| Molecular Formula | C24H14FN3O5S |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | [1-(6-fluoro-1,3-benzothiazol-2-yl)-4,5-dihydroxy-2-(3-nitrophenyl)pyrrol-3-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1c(O)c(O)n(-c2nc3ccc(F)cc3s2)c1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H14FN3O5S/c25-15-9-10-17-18(12-15)34-24(26-17)27-20(14-7-4-8-16(11-14)28(32)33)19(22(30)23(27)31)21(29)13-5-2-1-3-6-13/h1-12,30-31H |
| InChIKey | WISZXEVQAWLNAZ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 118.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|