C19H12N4O5S — CID 123659887
[4,5-dihydroxy-2-(3-nitrophenyl)-1-(1,3,4-thiadiazol-2-yl)pyrrol-3-yl]-phenylmethanone (PubChem CID 123659887) has the molecular formula C19H12N4O5S and a molecular weight of 408.40 g/mol. Its IUPAC name is [4,5-dihydroxy-2-(3-nitrophenyl)-1-(1,3,4-thiadiazol-2-yl)pyrrol-3-yl]-phenylmethanone.
| Compound Name | [4,5-dihydroxy-2-(3-nitrophenyl)-1-(1,3,4-thiadiazol-2-yl)pyrrol-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 123659887 |
| Molecular Formula | C19H12N4O5S |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | [4,5-dihydroxy-2-(3-nitrophenyl)-1-(1,3,4-thiadiazol-2-yl)pyrrol-3-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1c(O)c(O)n(-c2nncs2)c1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H12N4O5S/c24-16(11-5-2-1-3-6-11)14-15(12-7-4-8-13(9-12)23(27)28)22(18(26)17(14)25)19-21-20-10-29-19/h1-10,25-26H |
| InChIKey | ZQNYNLINSMXHRG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 131.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|