C22H17N3O6S — CID 123945953
[4,5-dihydroxy-2-(4-nitrophenyl)-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-(4-ethoxyphenyl)methanone (PubChem CID 123945953) has the molecular formula C22H17N3O6S and a molecular weight of 451.46 g/mol. Its IUPAC name is [4,5-dihydroxy-2-(4-nitrophenyl)-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-(4-ethoxyphenyl)methanone.
| Compound Name | [4,5-dihydroxy-2-(4-nitrophenyl)-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-(4-ethoxyphenyl)methanone |
|---|---|
| PubChem CID | 123945953 |
| Molecular Formula | C22H17N3O6S |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | [4,5-dihydroxy-2-(4-nitrophenyl)-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-(4-ethoxyphenyl)methanone |
| SMILES | CCOc1ccc(C(=O)c2c(O)c(O)n(-c3nccs3)c2-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C22H17N3O6S/c1-2-31-16-9-5-14(6-10-16)19(26)17-18(13-3-7-15(8-4-13)25(29)30)24(21(28)20(17)27)22-23-11-12-32-22/h3-12,27-28H,2H2,1H3 |
| InChIKey | UZLFTBPCVFNFPX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|