C15H10N4O3 — CID 163853349
(3-nitrophenyl)-(4-phenyl-1,2,4-triazol-3-yl)methanone (PubChem CID 163853349) has the molecular formula C15H10N4O3 and a molecular weight of 294.27 g/mol. Its IUPAC name is (3-nitrophenyl)-(4-phenyl-1,2,4-triazol-3-yl)methanone.
| Compound Name | (3-nitrophenyl)-(4-phenyl-1,2,4-triazol-3-yl)methanone |
|---|---|
| PubChem CID | 163853349 |
| Molecular Formula | C15H10N4O3 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | (3-nitrophenyl)-(4-phenyl-1,2,4-triazol-3-yl)methanone |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)c1nncn1-c1ccccc1 |
| InChI | InChI=1S/C15H10N4O3/c20-14(11-5-4-8-13(9-11)19(21)22)15-17-16-10-18(15)12-6-2-1-3-7-12/h1-10H |
| InChIKey | OWFRWRBCUKDDDC-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 90.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|