C23H18N6O3S — CID 108771500
[2-[[6-(3-nitrophenyl)pyridazin-3-yl]amino]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]-phenylmethanone (PubChem CID 108771500) has the molecular formula C23H18N6O3S and a molecular weight of 458.50 g/mol. Its IUPAC name is [2-[[6-(3-nitrophenyl)pyridazin-3-yl]amino]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]-phenylmethanone.
| Compound Name | [2-[[6-(3-nitrophenyl)pyridazin-3-yl]amino]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 108771500 |
| Molecular Formula | C23H18N6O3S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | [2-[[6-(3-nitrophenyl)pyridazin-3-yl]amino]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCc2nc(Nc3ccc(-c4cccc([N+](=O)[O-])c4)nn3)sc2C1 |
| InChI | InChI=1S/C23H18N6O3S/c30-22(15-5-2-1-3-6-15)28-12-11-19-20(14-28)33-23(24-19)25-21-10-9-18(26-27-21)16-7-4-8-17(13-16)29(31)32/h1-10,13H,11-12,14H2,(H,24,25,27) |
| InChIKey | YLZQFIJSBIRITH-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|