C22H20N6O3S — CID 108776638
6-(morpholin-4-ylmethyl)-N-[6-(3-nitrophenyl)pyridazin-3-yl]-1,3-benzothiazol-2-amine (PubChem CID 108776638) has the molecular formula C22H20N6O3S and a molecular weight of 448.51 g/mol. Its IUPAC name is 6-(morpholin-4-ylmethyl)-N-[6-(3-nitrophenyl)pyridazin-3-yl]-1,3-benzothiazol-2-amine.
| Compound Name | 6-(morpholin-4-ylmethyl)-N-[6-(3-nitrophenyl)pyridazin-3-yl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 108776638 |
| Molecular Formula | C22H20N6O3S |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 6-(morpholin-4-ylmethyl)-N-[6-(3-nitrophenyl)pyridazin-3-yl]-1,3-benzothiazol-2-amine |
| SMILES | O=[N+]([O-])c1cccc(-c2ccc(Nc3nc4ccc(CN5CCOCC5)cc4s3)nn2)c1 |
| InChI | InChI=1S/C22H20N6O3S/c29-28(30)17-3-1-2-16(13-17)18-6-7-21(26-25-18)24-22-23-19-5-4-15(12-20(19)32-22)14-27-8-10-31-11-9-27/h1-7,12-13H,8-11,14H2,(H,23,24,26) |
| InChIKey | RGLCUJRVXRHLHI-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|