C20H22N4O3S — CID 56573944
N-[[3-[(2-methylmorpholin-4-yl)methyl]phenyl]methyl]-6-nitro-1,3-benzothiazol-2-amine (PubChem CID 56573944) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is N-[[3-[(2-methylmorpholin-4-yl)methyl]phenyl]methyl]-6-nitro-1,3-benzothiazol-2-amine.
| Compound Name | N-[[3-[(2-methylmorpholin-4-yl)methyl]phenyl]methyl]-6-nitro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 56573944 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | N-[[3-[(2-methylmorpholin-4-yl)methyl]phenyl]methyl]-6-nitro-1,3-benzothiazol-2-amine |
| SMILES | CC1CN(Cc2cccc(CNc3nc4ccc([N+](=O)[O-])cc4s3)c2)CCO1 |
| InChI | InChI=1S/C20H22N4O3S/c1-14-12-23(7-8-27-14)13-16-4-2-3-15(9-16)11-21-20-22-18-6-5-17(24(25)26)10-19(18)28-20/h2-6,9-10,14H,7-8,11-13H2,1H3,(H,21,22) |
| InChIKey | CSULKJIOWPXKJQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|