C20H22N4O4S — CID 56574077
N-[[3-(2-morpholin-4-ylethoxy)phenyl]methyl]-6-nitro-1,3-benzothiazol-2-amine (PubChem CID 56574077) has the molecular formula C20H22N4O4S and a molecular weight of 414.49 g/mol. Its IUPAC name is N-[[3-(2-morpholin-4-ylethoxy)phenyl]methyl]-6-nitro-1,3-benzothiazol-2-amine.
| Compound Name | N-[[3-(2-morpholin-4-ylethoxy)phenyl]methyl]-6-nitro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 56574077 |
| Molecular Formula | C20H22N4O4S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | N-[[3-(2-morpholin-4-ylethoxy)phenyl]methyl]-6-nitro-1,3-benzothiazol-2-amine |
| SMILES | O=[N+]([O-])c1ccc2nc(NCc3cccc(OCCN4CCOCC4)c3)sc2c1 |
| InChI | InChI=1S/C20H22N4O4S/c25-24(26)16-4-5-18-19(13-16)29-20(22-18)21-14-15-2-1-3-17(12-15)28-11-8-23-6-9-27-10-7-23/h1-5,12-13H,6-11,14H2,(H,21,22) |
| InChIKey | PPSMTKAACDUTCO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 89.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|