C17H16ClN5O3S — CID 87379376
N-[6-chloro-4-(morpholin-4-ylmethyl)-2-pyridinyl]-6-nitro-1,3-benzothiazol-2-amine (PubChem CID 87379376) has the molecular formula C17H16ClN5O3S and a molecular weight of 405.87 g/mol. Its IUPAC name is N-[6-chloro-4-(morpholin-4-ylmethyl)-2-pyridinyl]-6-nitro-1,3-benzothiazol-2-amine.
| Compound Name | N-[6-chloro-4-(morpholin-4-ylmethyl)-2-pyridinyl]-6-nitro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 87379376 |
| Molecular Formula | C17H16ClN5O3S |
| Molecular Weight | 405.87 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | N-[6-chloro-4-(morpholin-4-ylmethyl)-2-pyridinyl]-6-nitro-1,3-benzothiazol-2-amine |
| SMILES | O=[N+]([O-])c1ccc2nc(Nc3cc(CN4CCOCC4)cc(Cl)n3)sc2c1 |
| InChI | InChI=1S/C17H16ClN5O3S/c18-15-7-11(10-22-3-5-26-6-4-22)8-16(20-15)21-17-19-13-2-1-12(23(24)25)9-14(13)27-17/h1-2,7-9H,3-6,10H2,(H,19,20,21) |
| InChIKey | ZMOHESPDTBSKTL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.87 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|