C12H9N5O4S3 — CID 100974632
N-[4-(2-amino-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]-3-nitrobenzenesulfonamide (PubChem CID 100974632) has the molecular formula C12H9N5O4S3 and a molecular weight of 383.44 g/mol. Its IUPAC name is N-[4-(2-amino-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]-3-nitrobenzenesulfonamide.
| Compound Name | N-[4-(2-amino-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 100974632 |
| Molecular Formula | C12H9N5O4S3 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 382.98 |
| IUPAC Name | N-[4-(2-amino-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]-3-nitrobenzenesulfonamide |
| SMILES | Nc1nc(-c2csc(NS(=O)(=O)c3cccc([N+](=O)[O-])c3)n2)cs1 |
| InChI | InChI=1S/C12H9N5O4S3/c13-11-14-9(5-22-11)10-6-23-12(15-10)16-24(20,21)8-3-1-2-7(4-8)17(18)19/h1-6H,(H2,13,14)(H,15,16) |
| InChIKey | PEEHJMAGEGZPDR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|