C22H14N4O2S2 — CID 103597594
4-[2-[2-[(4-nitrophenyl)methylsulfanyl]-4-pyridinyl]-1,3-thiazol-4-yl]benzonitrile (PubChem CID 103597594) has the molecular formula C22H14N4O2S2 and a molecular weight of 430.51 g/mol. Its IUPAC name is 4-[2-[2-[(4-nitrophenyl)methylsulfanyl]-4-pyridinyl]-1,3-thiazol-4-yl]benzonitrile.
| Compound Name | 4-[2-[2-[(4-nitrophenyl)methylsulfanyl]-4-pyridinyl]-1,3-thiazol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 103597594 |
| Molecular Formula | C22H14N4O2S2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | 4-[2-[2-[(4-nitrophenyl)methylsulfanyl]-4-pyridinyl]-1,3-thiazol-4-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2csc(-c3ccnc(SCc4ccc([N+](=O)[O-])cc4)c3)n2)cc1 |
| InChI | InChI=1S/C22H14N4O2S2/c23-12-15-1-5-17(6-2-15)20-14-30-22(25-20)18-9-10-24-21(11-18)29-13-16-3-7-19(8-4-16)26(27)28/h1-11,14H,13H2 |
| InChIKey | UFZOJKCJLFVQBR-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 92.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|