C23H19N3O4S2 — CID 103597321
4-(2,5-dimethoxyphenyl)-2-[2-[(3-nitrophenyl)methylsulfanyl]-4-pyridinyl]-1,3-thiazole (PubChem CID 103597321) has the molecular formula C23H19N3O4S2 and a molecular weight of 465.56 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)-2-[2-[(3-nitrophenyl)methylsulfanyl]-4-pyridinyl]-1,3-thiazole.
| Compound Name | 4-(2,5-dimethoxyphenyl)-2-[2-[(3-nitrophenyl)methylsulfanyl]-4-pyridinyl]-1,3-thiazole |
|---|---|
| PubChem CID | 103597321 |
| Molecular Formula | C23H19N3O4S2 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)-2-[2-[(3-nitrophenyl)methylsulfanyl]-4-pyridinyl]-1,3-thiazole |
| SMILES | COc1ccc(OC)c(-c2csc(-c3ccnc(SCc4cccc([N+](=O)[O-])c4)c3)n2)c1 |
| InChI | InChI=1S/C23H19N3O4S2/c1-29-18-6-7-21(30-2)19(12-18)20-14-32-23(25-20)16-8-9-24-22(11-16)31-13-15-4-3-5-17(10-15)26(27)28/h3-12,14H,13H2,1-2H3 |
| InChIKey | KWXGDLNRUQMOJC-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 87.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|